CAS 77242-30-9

2-Amino-5-nitrobenzenemethanol

Description:

2-Amino-5-nitrobenzenemethanol, with the CAS number 77242-30-9, is an organic compound characterized by the presence of an amino group (-NH2), a nitro group (-NO2), and a hydroxymethyl group (-CH2OH) attached to a benzene ring. This compound typically appears as a solid and is soluble in polar solvents due to the hydroxymethyl group, which enhances its hydrophilicity. The amino group can participate in hydrogen bonding, influencing its reactivity and interaction with other chemical species. The nitro group, being an electron-withdrawing group, can affect the compound's electronic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. Additionally, the presence of both amino and nitro groups suggests potential applications in pharmaceuticals, dyes, or as intermediates in organic synthesis. Safety data should be consulted, as compounds with nitro groups can sometimes exhibit hazardous properties, including toxicity or explosive potential under certain conditions.

Formula: C₇H₈N₂O₃

InChI: InChI=1S/C7H8N2O3/c8-7-2-1-6(9(11)12)3-5(7)4-10/h1-3,10H,4,8H2

InChI key: InChIKey=XEALBFKUNCXFTO-UHFFFAOYSA-N

SMILES: C(O)C1=CC(N(=O)=O)=CC=C1N

Synonyms:

• (2-Amino-5-Nitrophenyl)Methanol
• 2-Amino-5-nitrobenzenemethanol
• 2-Hydroxymethyl-4-Nitroaniline
• Benzenemethanol, 2-amino-5-nitro-
• 2-Amino-5-nitrobenzyl alcohol

2-Amino-5-nitrobenzyl alcohol

CAS: 77242-30-9

2-Amino-5-nitrobenzyl alcohol

Purity: 97%

Color and Shape: Solid

Molecular weight: 168.15g/mol

Ref: 54-OR917871

(2-Amino-5-nitrophenyl)methanol

CAS: 77242-30-9

Formula: C₇H₈N₂O₃

Purity: 98%

Molecular weight: 168.152

Ref: 10-F544945

2-Amino-5-nitrobenzyl alcohol

CAS: 77242-30-9

Versatile small molecule scaffold

Formula: C₇H₈N₂O₃

Purity: Min. 95%

Molecular weight: 168.15 g/mol

Ref: 3D-CDA24230