CAS 77252-87-0

N-[2-Hydroxy-3-(1-naphthalenyloxy)propyl]-N-(1-methylethyl)formamide

Description:

N-[2-Hydroxy-3-(1-naphthalenyloxy)propyl]-N-(1-methylethyl)formamide, with CAS number 77252-87-0, is a chemical compound characterized by its complex structure that includes a formamide functional group, a hydroxy group, and a naphthalenyloxy moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential interactions with biological systems due to its functional groups. The presence of the naphthalene ring suggests possible aromatic characteristics, which may contribute to its stability and reactivity. Additionally, the hydroxy group can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. The compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and unique structural features. However, specific applications and safety profiles would require further investigation and analysis in the context of its intended use.

Formula: C₁₇H₂₁NO₃

InChI: InChI=1S/C17H21NO3/c1-13(2)18(12-19)10-15(20)11-21-17-9-5-7-14-6-3-4-8-16(14)17/h3-9,12-13,15,20H,10-11H2,1-2H3

InChI key: InChIKey=HYXSVEOUQCJDND-UHFFFAOYSA-N

SMILES: O(CC(CN(C(C)C)C=O)O)C=1C2=C(C=CC1)C=CC=C2

Synonyms:

• N-Formylpropranolol
• Formamide, N-[2-hydroxy-3-(1-naphthalenyloxy)propyl]-N-(1-methylethyl)-
• N-[2-Hydroxy-3-(1-naphthalenyloxy)propyl]-N-(1-methylethyl)formamide

Propranolol Impurity 2

CAS: 77252-87-0

Formula: C₁₇H₂₁NO₃

Color and Shape: Colorless Liquid

Molecular weight: 287.36

Ref: 4Z-P-1614

N-Formylpropranolol

Controlled Product

CAS: 77252-87-0

Formula: C₁₇H₂₁NO₃

Color and Shape: Neat

Molecular weight: 287.353

Ref: TR-F772520

Propranolol N-Formyl Impurity

CAS: 77252-87-0

Formula: C₁₇H₂₁NO₃

Molecular weight: 287.36

Ref: ST-EA-CP-P31013