CAS 77262-39-6

2,2,2-trifluoro-N-pyridin-4-ylacetamide

Description:

2,2,2-Trifluoro-N-pyridin-4-ylacetamide is a chemical compound characterized by its unique structure, which includes a trifluoroacetamide group and a pyridine ring. The presence of three fluorine atoms contributes to its high electronegativity and potential for strong intermolecular interactions, such as hydrogen bonding. This compound is typically a solid at room temperature and is soluble in polar organic solvents due to the polar nature of the trifluoroacetamide functional group. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. The pyridine moiety can enhance the compound's ability to interact with biological targets, while the trifluoromethyl group can influence its lipophilicity and metabolic stability. Safety data should be consulted for handling and exposure, as fluorinated compounds can have specific environmental and health considerations. Overall, 2,2,2-trifluoro-N-pyridin-4-ylacetamide is a versatile compound with potential applications in medicinal chemistry and material science.

Formula: C₇H₅F₃N₂O

InChI: InChI=1/C7H5F3N2O/c8-7(9,10)6(13)12-5-1-3-11-4-2-5/h1-4H,(H,11,12,13)

SMILES: c1c[nH]ccc1=NC(=O)C(F)(F)F

Synonyms:

• 2,2,2-Trifluoro-N-(pyridin-4-yl)acetamide
• acetamide, 2,2,2-trifluoro-N-4-pyridinyl-

4-(Trifluoroacetamido)pyridine

CAS: 77262-39-6

4-(Trifluoroacetamido)pyridine

Purity: 97%

Molecular weight: 190.12g/mol

Ref: 54-PC6893