
CAS 77265-67-9
:Benzoic acid, 4-(2-aminoethyl)-, methyl ester
Description:
Benzoic acid, 4-(2-aminoethyl)-, methyl ester, with the CAS number 77265-67-9, is an organic compound characterized by its ester functional group and an aminoethyl side chain. This compound features a benzoic acid moiety, which contributes to its aromatic properties, and a methyl ester group that enhances its solubility in organic solvents. The presence of the aminoethyl group introduces basicity and potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. Typically, this compound may exhibit moderate to low toxicity, and its physical properties, such as melting point and boiling point, can vary based on the specific molecular structure and purity. It is often used in chemical synthesis, pharmaceuticals, and as an intermediate in the production of various compounds. Additionally, its derivatives may have applications in biological systems, potentially serving as precursors for bioactive molecules. As with any chemical substance, proper handling and safety precautions are essential due to potential health and environmental impacts.
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c1-13-10(12)9-4-2-8(3-5-9)6-7-11/h2-5H,6-7,11H2,1H3
InChI key:InChIKey=XGBXOGQDEAGJKO-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=C(CCN)C=C1
Synonyms:- Methyl 4-(2-aminoethyl)benzoate
- Benzoic acid, 4-(2-aminoethyl)-, methyl ester
- 4-(2-Aminoethyl)benzoic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.