CAS 77273-75-7

4-(9H-xanthen-9-yl)phenol

Description:

4-(9H-xanthen-9-yl)phenol, also known by its CAS number 77273-75-7, is an organic compound characterized by its structure, which features a phenolic group attached to a xanthenyl moiety. This compound typically exhibits properties associated with both phenols and xanthene derivatives, including potential applications in fluorescence and as a dye. It is often recognized for its ability to absorb light in the ultraviolet-visible spectrum, making it useful in various photochemical applications. The presence of the hydroxyl (-OH) group contributes to its solubility in polar solvents and enhances its reactivity, particularly in electrophilic substitution reactions. Additionally, 4-(9H-xanthen-9-yl)phenol may exhibit antioxidant properties, which can be beneficial in various chemical and biological contexts. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest in both synthetic and applied chemistry. Overall, this compound serves as a valuable building block in organic synthesis and materials science.

Formula: C₁₉H₁₄O₂

InChI: InChI=1/C19H14O2/c20-14-11-9-13(10-12-14)19-15-5-1-3-7-17(15)21-18-8-4-2-6-16(18)19/h1-12,19-20H

Synonyms:

• phenol, 4-(9H-xanthen-9-yl)-
• A 274
• 4-(9H-xanthen-9-yl)phenol

A 274

CAS: 77273-75-7

A 274 is a highly aromatic, monosubstituted phenol antioxidant generated during differentiation of neuroblastoma cells.

Formula: C₁₉H₁₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 274.31

Ref: TM-T26412