CAS 77278-71-8
:1-Piperazinecarboxylic acid, 4-(3-thienylmethyl)-, 1,1-dimethylethyl ester
Description:
1-Piperazinecarboxylic acid, 4-(3-thienylmethyl)-, 1,1-dimethylethyl ester, identified by CAS number 77278-71-8, is an organic compound characterized by its piperazine core, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound features a thienylmethyl group, indicating the presence of a thiophene ring, which contributes to its unique chemical properties and potential biological activity. The ester functional group, derived from the carboxylic acid, suggests that this compound may exhibit lipophilic characteristics, enhancing its solubility in organic solvents. The presence of the tert-butyl group (1,1-dimethylethyl) further increases the steric bulk around the ester, potentially influencing its reactivity and interactions with biological targets. Overall, this compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could impart specific biological activities or therapeutic effects. However, detailed studies would be necessary to elucidate its full chemical behavior and potential applications.
Formula:C14H22N2O2S
InChI:InChI=1S/C14H22N2O2S/c1-14(2,3)18-13(17)16-7-5-15(6-8-16)10-12-4-9-19-11-12/h4,9,11H,5-8,10H2,1-3H3
InChI key:InChIKey=ISKGEBPNAREAKZ-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCN(CC=2C=CSC2)CC1
Synonyms:- 1,1-Dimethylethyl 4-(3-thienylmethyl)-1-piperazinecarboxylate
- 1-Piperazinecarboxylic acid, 4-(3-thienylmethyl)-, 1,1-dimethylethyl ester
- 1-Boc-4-(3-Thienylmethyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
