CAS 77280-30-9

N-(4-chlorophenyl)-2,6-dimethylmorpholine-4-carboxamide

Description:

N-(4-chlorophenyl)-2,6-dimethylmorpholine-4-carboxamide, with the CAS number 77280-30-9, is a chemical compound that belongs to the class of morpholine derivatives. This substance features a morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom and five carbon atoms. The presence of a 4-chlorophenyl group indicates that a chlorine atom is substituted on the para position of a phenyl ring, contributing to the compound's lipophilicity and potential biological activity. The 2,6-dimethyl substituents on the morpholine ring enhance its steric properties and may influence its interaction with biological targets. This compound is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs with specific therapeutic effects. Its characteristics, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other chemical entities. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₇ClN₂O₂

InChI: InChI=1/C13H17ClN2O2/c1-9-7-16(8-10(2)18-9)13(17)15-12-5-3-11(14)4-6-12/h3-6,9-10H,7-8H2,1-2H3,(H,15,17)

SMILES: CC1CN(CC(C)O1)C(=O)Nc1ccc(cc1)Cl

N-(4-Chlorophenyl)-2,6-dimethylmorpholine-4-carboxamide

CAS: 77280-30-9

N-(4-Chlorophenyl)-2,6-dimethylmorpholine-4-carboxamide

Purity: ≥95%

Molecular weight: 268.74g/mol

Ref: 54-OR111039