CAS 77280-83-2

Copper(1+), (L-histidinato-κN,κN3,κO)-

Description:

Copper(1+), (L-histidinato-κN,κN3,κO)-, also known as copper(I) histidinate, is a coordination compound where copper is in the +1 oxidation state and is coordinated to the amino acid L-histidine. This compound features a bidentate ligand, where histidine binds through its nitrogen and oxygen atoms, forming a stable chelate complex. The presence of the imidazole side chain in histidine allows for versatile coordination modes, contributing to the compound's stability and reactivity. Copper(I) ions are known for their relatively low oxidation potential, making them less reactive than their copper(II) counterparts. This compound may exhibit biological significance, particularly in enzymatic processes and as a trace element in various biological systems. Its solubility and stability can vary depending on the pH and the presence of other ligands or ions in solution. Overall, copper(I) histidinate serves as an important model for studying copper's role in biological systems and its potential applications in biochemistry and medicine.

Formula: C₆H₈CuN₃O₂

InChI: InChI=1S/C6H9N3O2.Cu/c7-5(6(10)11)1-4-2-8-3-9-4;/h2-3,5H,1,7H2,(H,8,9)(H,10,11);/q;+2/p-1/t5-;/m0./s1

InChI key: InChIKey=RNHVHXAWESRSDJ-JEDNCBNOSA-M

SMILES: O=C1[O-][Cu+2]2[N]3(C(C[C@@]1([NH2]2)[H])=CN=C3)[H]

Synonyms:

• Copper(1+), (L-histidinato-N,N3,O)-
• L-Histidine, copper complex
• Copper(1+), (L-histidinato-κN,κN3,κO)-

Copper histidine

CAS: 77280-83-2

Copper histidine blocks Ctr1, reducing oxaliplatin uptake in cells, not affecting its levels or neurotoxicity in vivo. Used orally for Menkes disease.

Formula: C₆H₈CuN₃O₂

Purity: 96.81%

Color and Shape: Soild

Molecular weight: 217.69

Ref: TM-T67981

Copper histidine

CAS: 77280-83-2

Copper histidine

Purity: ≥95%

Molecular weight: 217.69g/mol

Ref: 54-BUP08048