CAS 7729-30-8
:D-Azetidine-2-carboxylic acid
Description:
D-Azetidine-2-carboxylic acid, with the CAS number 7729-30-8, is a cyclic amino acid characterized by a four-membered ring structure containing a nitrogen atom. This compound features a carboxylic acid functional group, which contributes to its acidic properties. D-Azetidine-2-carboxylic acid is known for its role as a structural analog of proline, influencing protein synthesis and folding due to its unique ring structure. It is typically a white to off-white crystalline solid, soluble in water and polar organic solvents. The presence of the carboxylic acid group allows it to participate in various chemical reactions, including esterification and amidation. This compound is of interest in biochemical research, particularly in studies related to protein structure and function, as well as in the synthesis of pharmaceuticals. Its stereochemistry, being a D-enantiomer, can affect its biological activity and interactions with enzymes and receptors. Overall, D-Azetidine-2-carboxylic acid serves as a valuable tool in both synthetic and biological chemistry.
Formula:C4H7NO2
InChI:InChI=1/C4H7NO2/c6-4(7)3-1-2-5-3/h3,5H,1-2H2,(H,6,7)/t3-/m1/s1
SMILES:C1CN[C@H]1C(=O)O
Synonyms:- (R)-Azetidine-2-carboxylic acid
- (2R)-azetidine-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(R)-Azetidine-2-carboxylic acid
CAS:Formula:C4H7NO2Purity:97%Color and Shape:SolidMolecular weight:101.1039Ref: IN-DA005CZZ
50gTo inquire100gTo inquire100mg27.00€250mg27.00€1g50.00€5g116.00€10g184.00€25g326.00€(R)-(+) Azetidine-2-carboxylic acid
CAS:(R)-(+) Azetidine-2-carboxylic acidPurity:95%Molecular weight:101.10g/mol(R)-Azetidine-2-carboxylic acid
CAS:Formula:C4H7NO2Purity:95%Color and Shape:Solid, Off-white powderMolecular weight:101.105D-Azetidine-2-Carboxylic Acid
CAS:Controlled ProductApplications D-Azetidine-2-carboxylic Acid is a four-membered ring analog of L-Proline. A useful intermediate in the synthesis of polypeptides.
References Barber, M., et al.: Int. J. Pept. Protein Res., 14(3), 247 (1979), Tsai., F.H., et al.: Biopolymers, 30(11-12), 1039 (1990)Formula:C4H7NO2Color and Shape:NeatMolecular weight:101.1




