CAS 77290-43-8

4-[Bis[4-(dimethylamino)phenyl]methyl]benzoic acid

Description:

4-[Bis[4-(dimethylamino)phenyl]methyl]benzoic acid, with the CAS number 77290-43-8, is an organic compound characterized by its complex structure, which includes a benzoic acid moiety and two dimethylamino-substituted phenyl groups. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in various fields, including organic synthesis and materials science. Its dimethylamino groups contribute to its basicity and potential reactivity, making it useful in dye chemistry and as a pH indicator. The presence of the carboxylic acid functional group allows for hydrogen bonding, influencing its solubility in polar solvents. Additionally, the compound may exhibit interesting optical properties, which can be leveraged in photonic applications. Overall, its unique structure and functional groups make it a subject of interest in both academic research and industrial applications.

Formula: C₂₄H₂₆N₂O₂

InChI: InChI=1S/C24H26N2O2/c1-25(2)21-13-9-18(10-14-21)23(17-5-7-20(8-6-17)24(27)28)19-11-15-22(16-12-19)26(3)4/h5-16,23H,1-4H3,(H,27,28)

InChI key: InChIKey=GNJAUKUSICXRTP-UHFFFAOYSA-N

SMILES: C(C1=CC=C(C(O)=O)C=C1)(C2=CC=C(N(C)C)C=C2)C3=CC=C(N(C)C)C=C3

Synonyms:

• Benzoic acid, 4-[bis[4-(dimethylamino)phenyl]methyl]-
• 4-[Bis[4-(dimethylamino)phenyl]methyl]benzoic acid