CAS 77290-89-2

2-Methyl-5-hexenoic acid

Description:

2-Methyl-5-hexenoic acid is an unsaturated fatty acid characterized by its aliphatic chain and a double bond in its structure. It features a carboxylic acid functional group, which imparts acidic properties and allows for hydrogen bonding. The presence of a double bond in the carbon chain contributes to its reactivity and potential for undergoing various chemical reactions, such as addition reactions. This compound is typically a colorless to pale yellow liquid at room temperature and has a distinctive odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic hydrocarbon chain. 2-Methyl-5-hexenoic acid is used in organic synthesis and may serve as an intermediate in the production of various chemicals, including surfactants and polymers. Safety considerations include handling it with care, as it may cause irritation to the skin and eyes. Proper storage in a cool, dry place away from incompatible substances is essential to maintain its stability and prevent degradation.

Formula: C₇H₁₂O₂

InChI: InChI=1S/C7H12O2/c1-3-4-5-6(2)7(8)9/h3,6H,1,4-5H2,2H3,(H,8,9)

InChI key: InChIKey=SXUXAXVRKXYXQZ-UHFFFAOYSA-N

SMILES: C(C(O)=O)(CCC=C)C

Synonyms:

• 5-Hexenoic acid, 2-methyl-
• 2-Methyl-5-hexenoic acid