CAS 77298-66-9
:7-hydroxy-2-(2-hydroxyphenyl)-4H-chromen-4-one
Description:
7-Hydroxy-2-(2-hydroxyphenyl)-4H-chromen-4-one, also known as a flavonoid compound, exhibits several notable characteristics. This substance features a chromone backbone, which is a fused benzopyran structure, and is substituted with hydroxyl groups that enhance its solubility and reactivity. The presence of multiple hydroxyl groups contributes to its potential antioxidant properties, making it of interest in various biological and pharmaceutical applications. This compound is typically characterized by its ability to absorb ultraviolet light, which can be attributed to its conjugated double bond system, allowing it to exhibit distinct color properties. Additionally, it may demonstrate biological activities such as anti-inflammatory, antimicrobial, and anticancer effects, although specific activities can vary based on the context of use and concentration. Its solubility in organic solvents and moderate stability under standard conditions make it suitable for various experimental applications in research and development. Overall, this compound represents a significant interest in the fields of natural products and medicinal chemistry.
Formula:C15H10O4
InChI:InChI=1/C15H10O4/c16-9-5-6-11-13(18)8-15(19-14(11)7-9)10-3-1-2-4-12(10)17/h1-8,16-17H
SMILES:c1ccc(c(c1)c1cc(=O)c2ccc(cc2o1)O)O
Synonyms:- 4H-1-benzopyran-4-one, 7-hydroxy-2-(2-hydroxyphenyl)-
- 7-Hydroxy-2-(2-hydroxyphenyl)-4H-chromen-4-on
- 7-Hydroxy-2-(2-hydroxyphényl)-4H-chromén-4-one
- 7-Hydroxy-2-(2-hydroxyphenyl)-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2',7-Dihydroxyflavone
CAS:2',7-Dihydroxyflavone is a natural flavonoid compound, which is derived from plant sources, particularly within the broader family of flavonoids known for their diverse biological activities. This compound exhibits its mode of action primarily through interactions with cellular signaling pathways, notably acting as a potent agonist for the TrkB receptor, a critical component in neurotrophic signaling. The activation of TrkB is pivotal in promoting neuronal survival, differentiation, and synaptic plasticity, making this compound of significant interest in the field of neuroscience.Formula:C15H10O4Purity:Min. 95%Color and Shape:PowderMolecular weight:254.24 g/mol2',7-Dihydroxyflavone
CAS:Controlled ProductFormula:C15H10O4Color and Shape:NeatMolecular weight:254.238

