CAS 773-17-1
:1,1,2,2,3,4,4,5-octafluorocyclopentane
Description:
1,1,2,2,3,4,4,5-octafluorocyclopentane is a perfluorinated compound characterized by its fully fluorinated cyclopentane structure. This substance is notable for its high thermal and chemical stability, which is a common trait among perfluorinated compounds due to the strong carbon-fluorine bonds. It is a colorless, odorless liquid at room temperature and exhibits low volatility. The presence of multiple fluorine atoms contributes to its hydrophobic and lipophobic properties, making it non-polar and insoluble in water. Additionally, it has a relatively low surface tension, which can influence its behavior in various applications. 1,1,2,2,3,4,4,5-octafluorocyclopentane is often used in specialized applications, including as a solvent or in the production of fluorinated polymers. Due to its environmental persistence and potential bioaccumulation, it is subject to regulatory scrutiny, particularly concerning its impact on human health and ecosystems. Overall, its unique properties make it a compound of interest in both industrial and environmental chemistry.
Formula:C5H2F8
InChI:InChI=1/C5H2F8/c6-1-3(8,9)2(7)5(12,13)4(1,10)11/h1-2H
SMILES:C1(C(C(C(C1(F)F)(F)F)F)(F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.