CAS 7730-21-4

2-Amino-4-fluoro-3-hydroxybenzoic acid

Description:

2-Amino-4-fluoro-3-hydroxybenzoic acid, also known as 4-Fluoro-3-hydroxyanthranilic acid, is an aromatic amino acid derivative characterized by the presence of an amino group (-NH2), a hydroxy group (-OH), and a fluoro substituent (-F) on a benzoic acid framework. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols due to its functional groups. The presence of the amino and hydroxy groups contributes to its potential as a ligand in coordination chemistry and its utility in pharmaceuticals, particularly in the synthesis of various bioactive compounds. The fluoro substituent can influence the compound's electronic properties and reactivity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific biological activities, which can be explored in various research contexts. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₇H₆FNO₃

InChI: InChI=1S/C7H6FNO3/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,10H,9H2,(H,11,12)

InChI key: InChIKey=JCBVKPZJRVEYCO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N)C(O)=C(F)C=C1

Synonyms:

• 2-Amino-3-hydroxy-4-fluorobenzoic acid
• 4-Fluoro-3-hydroxyanthranilic acid
• Benzoic Acid, 2-Amino-4-Fluoro-3-Hydroxy-
• 2-Amino-4-fluoro-3-hydroxybenzoic acid