CAS 773031-79-1

5,6-dihydro-2-methyl-4H-Pyrrolo[3,4-d]thiazole

Description:

5,6-Dihydro-2-methyl-4H-pyrrolo[3,4-d]thiazole is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a thiazole ring. This compound typically exhibits a range of chemical properties due to the presence of nitrogen and sulfur atoms in its structure, contributing to its potential reactivity and biological activity. It is generally soluble in organic solvents, and its stability can vary depending on environmental conditions such as temperature and pH. The presence of the methyl group at the 2-position of the pyrrole ring can influence its electronic properties and steric hindrance, potentially affecting its interactions with biological targets. Compounds of this class are often investigated for their pharmacological properties, including antimicrobial and anticancer activities. As with many heterocycles, the synthesis and functionalization of 5,6-dihydro-2-methyl-4H-pyrrolo[3,4-d]thiazole can be of significant interest in medicinal chemistry and materials science.

Formula: C₆H₈N₂S

InChI: InChI=1S/C6H8N2S/c1-4-8-5-2-7-3-6(5)9-4/h7H,2-3H2,1H3

SMILES: Cc1nc2CNCc2s1

Synonyms:

• 4H-Pyrrolo[3,4-d]thiazole, 5,6-dihydro-2-methyl-
• 2-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]thiazole

2-Methyl-5,6-dihydro-4H-pyrrolo[3,4-d]thiazole

CAS: 773031-79-1

Formula: C₆H₈N₂S

Molecular weight: 140.2061

Ref: IN-DA005CZL

2-Methyl-5,6-dihydro-4H-pyrrolo[3,4-d]thiazole

CAS: 773031-79-1

2-Methyl-5,6-dihydro-4H-pyrrolo[3,4-d]thiazole is a chemical compound that is used as a research chemical and in the synthesis of other compounds. It is also used as a speciality chemical and reagent. 2-Methyl-5,6-dihydro-4H-pyrrolo[3,4-d]thiazole has been used as a building block for the preparation of other compounds and can be found in complex natural products. The compound has shown to be versatile since it can be easily converted into other compounds through reaction with different functional groups.

Formula: C₆H₈N₂S

Purity: Min. 95%

Color and Shape: Solid

Molecular weight: 140.21 g/mol

Ref: 3D-FM51472