CAS 77308-57-7
:2-(9H-fluoren-2-ylcarbonyl)benzoic acid
Description:
2-(9H-fluoren-2-ylcarbonyl)benzoic acid, with the CAS number 77308-57-7, is an organic compound characterized by its unique structure that combines a fluorenyl moiety with a benzoic acid functional group. This compound typically exhibits properties such as being a solid at room temperature, with a relatively high melting point due to its aromatic nature and the presence of hydrogen bonding capabilities from the carboxylic acid group. It is generally soluble in organic solvents like dichloromethane and ethyl acetate, but may have limited solubility in water. The presence of both the fluorenyl and benzoic acid groups suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or as intermediates in chemical reactions. Additionally, its structure may impart interesting photophysical properties, making it a candidate for studies in materials science or photochemistry. Overall, this compound's characteristics make it a valuable substance in various chemical research fields.
Formula:C21H14O3
InChI:InChI=1/C21H14O3/c22-20(18-7-3-4-8-19(18)21(23)24)14-9-10-17-15(12-14)11-13-5-1-2-6-16(13)17/h1-10,12H,11H2,(H,23,24)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
NSC-77053
CAS:NSC-77053 is a BoNT/E inhibitor.Formula:C21H14O3Color and Shape:SolidMolecular weight:314.33
