CymitQuimica logo

CAS 773087-36-8

:

N-[3-(1,3-dioxolan-2-yl)-4-pyridyl]-2,2-dimethyl-propanamide

Description:
N-[3-(1,3-dioxolan-2-yl)-4-pyridyl]-2,2-dimethyl-propanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring and a dioxolane moiety. This compound typically exhibits properties associated with amides, such as moderate polarity and the ability to engage in hydrogen bonding due to the presence of the amide functional group. The dioxolane ring contributes to its cyclic structure, potentially influencing its solubility and reactivity. The presence of the dimethyl group enhances steric hindrance, which may affect its biological activity and interaction with other molecules. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, given the presence of the pyridine and dioxolane groups, which are often associated with bioactive compounds. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied.
Formula:C13H18N2O3
InChI:InChI=1/C13H18N2O3/c1-13(2,3)12(16)15-10-4-5-14-8-9(10)11-17-6-7-18-11/h4-5,8,11H,6-7H2,1-3H3,(H,14,15,16)
SMILES:CC(C)(C)C(=O)N=c1cc[nH]cc1C1OCCO1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.