CAS 773087-37-9
:1-(1,3-Dioxolan-2-yl)-2,2,2-trifluoroethanone
Description:
1-(1,3-Dioxolan-2-yl)-2,2,2-trifluoroethanone, identified by its CAS number 773087-37-9, is an organic compound characterized by the presence of a dioxolane ring and a trifluoroethanone functional group. This compound features a five-membered cyclic ether (the dioxolane) which contributes to its stability and reactivity. The trifluoroethanone moiety introduces significant electronegativity due to the presence of three fluorine atoms, which can enhance the compound's reactivity in nucleophilic substitution reactions and influence its physical properties, such as boiling point and solubility. The presence of the dioxolane ring may also impart unique characteristics, such as potential applications in organic synthesis or as a solvent. Additionally, the compound's structure suggests it may exhibit interesting interactions with biological systems, making it a candidate for further research in medicinal chemistry or materials science. Overall, its unique combination of functional groups makes it a compound of interest in various chemical applications.
Formula:C5H5F3O3
InChI:InChI=1S/C5H5F3O3/c6-5(7,8)3(9)4-10-1-2-11-4/h4H,1-2H2
InChI key:InChIKey=VQRLNOZAEUFZCX-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1OCCO1
Synonyms:- 1-(1,3-Dioxolan-2-yl)-2,2,2-trifluoroethanone
- Ethanone, 1-(1,3-dioxolan-2-yl)-2,2,2-trifluoro- (9CI)
- Ethanone, 1-(1,3-dioxolan-2-yl)-2,2,2-trifluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.