CAS 773099-18-6

2-Bromo-1-methyl-1H-imidazole-4,5-dicarboxylic acid

Description:

2-Bromo-1-methyl-1H-imidazole-4,5-dicarboxylic acid is a heterocyclic organic compound characterized by its imidazole ring structure, which contains both bromine and carboxylic acid functional groups. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and solubility. The two carboxylic acid groups contribute to its acidity and potential for forming salts or esters. This compound is likely to exhibit polar characteristics due to the carboxylic acid groups, making it soluble in polar solvents such as water. Additionally, the imidazole ring can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its unique structure may also impart biological activity, making it of interest in pharmaceutical and agrochemical research. Overall, 2-Bromo-1-methyl-1H-imidazole-4,5-dicarboxylic acid is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₆H₅BrN₂O₄

InChI: InChI=1S/C6H5BrN2O4/c1-9-3(5(12)13)2(4(10)11)8-6(9)7/h1H3,(H,10,11)(H,12,13)

InChI key: InChIKey=ADLLKSGOHGFCFD-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C(O)=O)N=C(Br)N1C

Synonyms:

• 1H-Imidazole-4,5-dicarboxylic acid, 2-bromo-1-methyl-
• 2-Bromo-1-methyl-1H-imidazole-4,5-dicarboxylic acid