CAS 773100-29-1

1-(4-fluorophenyl)cyclopropanecarboxylic acid

Description:

1-(4-Fluorophenyl)cyclopropanecarboxylic acid is an organic compound characterized by its cyclopropane structure, which is a three-membered carbon ring, and a carboxylic acid functional group. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the para position of a phenyl ring, which can influence the compound's reactivity and physical properties. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, with limited solubility in water due to its hydrophobic cyclopropane and aromatic components. The carboxylic acid group contributes to its acidity, making it capable of participating in various chemical reactions, such as esterification or amidation. Additionally, the fluorine atom can enhance the compound's biological activity and lipophilicity, making it of interest in pharmaceutical research. Overall, 1-(4-fluorophenyl)cyclopropanecarboxylic acid serves as a valuable building block in organic synthesis and medicinal chemistry.

Formula: C₁₀H₉FO₂

InChI: InChI=1/C10H9FO2/c11-8-3-1-7(2-4-8)10(5-6-10)9(12)13/h1-4H,5-6H2,(H,12,13)

SMILES: c1cc(ccc1C1(CC1)C(=O)O)F

Synonyms:

• Cyclopropanecarboxylic acid, 1-(4-fluorophenyl)-

1-(4-Fluorophenyl)cyclopropanecarboxylic acid

CAS: 773100-29-1

Formula: C₁₀H₉FO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 180.1757

Ref: IN-DA003CZM

1-(4-Fluorophenyl)cyclopropanecarboxylic acid

CAS: 773100-29-1

1-(4-Fluorophenyl)cyclopropanecarboxylic acid

Formula: C₁₀H₉FO₂

Purity: 99%

Color and Shape: white solid

Molecular weight: 180.18g/mol

Ref: 54-PC404539

1-(4-fluorophenyl)cyclopropanecarboxylic acid

CAS: 773100-29-1

Formula: C₁₀H₉FO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 180.178

Ref: 10-F309423