CAS 773108-64-8

4-amino-2,5-difluorobenzoic acid

Description:

4-Amino-2,5-difluorobenzoic acid is an aromatic compound characterized by the presence of an amino group and two fluorine atoms on a benzoic acid framework. Its molecular structure features a benzene ring substituted with an amino group at the para position relative to the carboxylic acid group, and fluorine atoms at the ortho and meta positions. This compound is typically a white to off-white solid and is soluble in polar solvents due to the carboxylic acid functionality. The presence of fluorine atoms enhances its chemical stability and can influence its reactivity and biological activity. 4-Amino-2,5-difluorobenzoic acid may be utilized in various applications, including pharmaceuticals and agrochemicals, owing to its potential as a building block in the synthesis of more complex molecules. Additionally, its unique electronic properties due to the fluorine substituents can affect its interaction with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₇H₅F₂NO₂

InChI: InChI=1/C7H5F2NO2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,10H2,(H,11,12)

SMILES: c1c(c(cc(c1F)N)F)C(=O)O

Synonyms:

• Benzoic acid, 4-amino-2,5-difluoro-
• 2,5-difluoro-4-aminobenzoic acid
• 4-Amino-2,5-Difluorobenzoic Acid

4-Amino-2,5-difluorobenzoic acid

CAS: 773108-64-8

Formula: C₇H₅F₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 173.1169

Ref: IN-DA005NQG

4-Amino-2,5-difluorobenzoic acid

CAS: 773108-64-8

4-Amino-2,5-difluorobenzoic acid

Formula: C₇H₅F₂NO₂

Purity: 95%

Color and Shape: off-white to faint brown powder

Molecular weight: 173.12g/mol

Ref: 54-PC902764

4-Amino-2,5-difluorobenzoic acid

CAS: 773108-64-8

Formula: C₇H₅F₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 173.119

Ref: 10-F037150