CAS 773109-06-1
:2-(piperazin-1-ylmethyl)benzoic acid
Description:
2-(Piperazin-1-ylmethyl)benzoic acid, with the CAS number 773109-06-1, is an organic compound characterized by its piperazine and benzoic acid moieties. This compound features a benzoic acid group attached to a piperazine ring via a methylene (-CH2-) linker, which contributes to its potential biological activity. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and ethanol, reflecting its ability to engage in hydrogen bonding due to the carboxylic acid functional group. The presence of the piperazine ring may impart basic properties, allowing it to interact with various biological targets, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting neurological or psychiatric conditions. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C12H16N2O2
InChI:InChI=1/C12H16N2O2/c15-12(16)11-4-2-1-3-10(11)9-14-7-5-13-6-8-14/h1-4,13H,5-9H2,(H,15,16)
SMILES:c1ccc(c(c1)CN1CCNCC1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.