CAS 77312-66-4

3-acetyl-3,12-dihydroxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxyhexopyranoside

Description:

3-acetyl-3,12-dihydroxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxyhexopyranoside is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as acetyl, hydroxy, and amino groups. This compound features a tetracene backbone, which contributes to its potential electronic and optical properties. The presence of hydroxyl groups suggests it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The amino group indicates potential for biological activity, possibly interacting with various biological targets. Its trideoxyhexopyranoside moiety suggests it may have glycosidic properties, which could be relevant in biochemical applications. The compound's unique structure may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Overall, the characteristics of this substance highlight its potential utility in various fields, including pharmaceuticals and materials science, although specific applications would depend on further research and characterization.

Formula: C₂₆H₂₇NO₈

InChI: InChI=1/C26H27NO8/c1-11-22(29)17(27)8-19(34-11)35-18-10-26(33,12(2)28)9-13-7-16-21(25(32)20(13)18)24(31)15-6-4-3-5-14(15)23(16)30/h3-7,11,17-19,22,29,32-33H,8-10,27H2,1-2H3

SMILES: CC1C(C(CC(O1)OC1CC(Cc2cc3c(C(=O)c4ccccc4C3=O)c(c12)O)(C(=O)C)O)N)O

4-Demethoxy-11-deoxydaunorubicin

Controlled Product

CAS: 77312-66-4

Applications 4-Demethoxy-11-deoxydaunorubicin is an antitumor anthracycline daunomycin.
References Ranghino, G., et. al.: J. Mol. Struct., 36, 287 (1987)

Formula: C₂₆H₂₇NO₈

Color and Shape: Neat

Molecular weight: 481.495

Ref: TR-D231435