CAS 773122-11-5

β-Amino-3-bromo-4-hydroxy-5-methoxybenzenepropanoic acid

Description:

β-Amino-3-bromo-4-hydroxy-5-methoxybenzenepropanoic acid, with the CAS number 773122-11-5, is an organic compound characterized by its complex structure, which includes an amino group, a bromine atom, and multiple functional groups such as hydroxyl and methoxy groups attached to a benzene ring. This compound typically exhibits properties associated with both amino acids and phenolic compounds, including potential solubility in polar solvents due to the presence of the hydroxyl group. The bromine substituent may influence its reactivity and biological activity, potentially making it useful in medicinal chemistry or as a biochemical probe. The methoxy group can enhance lipophilicity, affecting the compound's interaction with biological membranes. Additionally, the presence of the propanoic acid moiety suggests that it may participate in various biochemical pathways, possibly acting as a neurotransmitter or modulator. Overall, this compound's unique combination of functional groups contributes to its potential applications in pharmaceuticals and research.

Formula: C₁₀H₁₂BrNO₄

InChI: InChI=1S/C10H12BrNO4/c1-16-8-3-5(2-6(11)10(8)15)7(12)4-9(13)14/h2-3,7,15H,4,12H2,1H3,(H,13,14)

InChI key: InChIKey=KAIRXKGTHYKGLW-UHFFFAOYSA-N

SMILES: C(CC(O)=O)(N)C1=CC(OC)=C(O)C(Br)=C1

Synonyms:

• β-Amino-3-bromo-4-hydroxy-5-methoxybenzenepropanoic acid
• Benzenepropanoic acid, β-amino-3-bromo-4-hydroxy-5-methoxy-