CAS 773122-83-1

β-Amino-2-(trifluoromethoxy)benzenepropanoic acid

Description:

β-Amino-2-(trifluoromethoxy)benzenepropanoic acid, identified by its CAS number 773122-83-1, is an organic compound characterized by the presence of both an amino group and a carboxylic acid group, making it an amino acid derivative. The trifluoromethoxy group contributes to its unique chemical properties, enhancing its polarity and potentially influencing its reactivity and solubility in various solvents. This compound typically exhibits a crystalline solid form and is soluble in polar solvents due to the presence of the carboxylic acid and amino functionalities. Its trifluoromethoxy substituent can impart distinctive electronic effects, which may affect its biological activity and interactions with other molecules. β-Amino-2-(trifluoromethoxy)benzenepropanoic acid may be of interest in pharmaceutical research, particularly in the development of compounds with specific biological activities or as intermediates in organic synthesis. As with many fluorinated compounds, it may also exhibit unique properties such as increased metabolic stability or altered pharmacokinetics.

Formula: C₁₀H₁₀F₃NO₃

InChI: InChI=1S/C10H10F3NO3/c11-10(12,13)17-8-4-2-1-3-6(8)7(14)5-9(15)16/h1-4,7H,5,14H2,(H,15,16)

InChI key: InChIKey=OMUCIBHXELVTMP-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=C(C(CC(O)=O)N)C=CC=C1

Synonyms:

• 3-Amino-3-(2-Trifluoromethoxy-Phenyl)-Propionic Acid
• Rarechem Al Bl 0277
• β-Amino-2-(trifluoromethoxy)benzenepropanoic acid
• Benzenepropanoic acid, β-amino-2-(trifluoromethoxy)-