CymitQuimica logo

CAS 773123-81-2

:

3-(N-Cbz-Piperidin-4-yl)-3-aminopropanoic acid

Description:
3-(N-Cbz-Piperidin-4-yl)-3-aminopropanoic acid, identified by its CAS number 773123-81-2, is an organic compound characterized by the presence of a piperidine ring and an amino acid structure. The "N-Cbz" refers to a carbobenzyloxy protecting group attached to the nitrogen of the piperidine, which enhances the compound's stability and solubility. This compound features a propanoic acid backbone with an amino group, making it a derivative of an amino acid. It is typically used in peptide synthesis and medicinal chemistry due to its ability to serve as a building block for more complex molecules. The presence of the piperidine moiety contributes to its potential biological activity, as piperidine derivatives are often found in various pharmaceuticals. The compound is likely to exhibit moderate to high solubility in polar solvents, and its stability can be influenced by the conditions of storage and handling. Overall, this compound is of interest in the fields of organic synthesis and drug development.
Formula:C16H22N2O4
InChI:InChI=1/C16H22N2O4/c19-15(20)10-14(13-6-8-17-9-7-13)18-16(21)22-11-12-4-2-1-3-5-12/h1-5,13-14,17H,6-11H2,(H,18,21)(H,19,20)
SMILES:c1ccc(cc1)COC(=NC(CC(=O)O)C1CCNCC1)O
Synonyms:
  • beta-Amino-1-[(phenylmethoxy)carbonyl]-4-piperidinepropanoic acid
  • 3-Amino-3-(1-(Benzyloxycarbonyl)Piperidin-4-Yl)Propanoic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.