CAS 773126-11-7

β-Amino[1,1′-biphenyl]-2-propanoic acid

Description:

β-Amino[1,1′-biphenyl]-2-propanoic acid, identified by its CAS number 773126-11-7, is an organic compound characterized by the presence of an amino group and a propanoic acid moiety attached to a biphenyl structure. This compound typically exhibits properties associated with amino acids, such as the ability to form hydrogen bonds due to its amino and carboxylic acid functional groups. It is likely to be a white to off-white solid at room temperature, with moderate solubility in polar solvents like water and alcohols, owing to its ionic nature. The biphenyl structure contributes to its hydrophobic characteristics, which can influence its interactions in biological systems. This compound may have applications in pharmaceuticals or as a building block in organic synthesis, particularly in the development of biologically active molecules. Its specific reactivity and stability can vary based on environmental conditions such as pH and temperature, making it important to consider these factors in practical applications.

Formula: C₁₅H₁₅NO₂

InChI: InChI=1S/C15H15NO2/c16-14(10-15(17)18)13-9-5-4-8-12(13)11-6-2-1-3-7-11/h1-9,14H,10,16H2,(H,17,18)

InChI key: InChIKey=HAAUFDOFSYJMCU-UHFFFAOYSA-N

SMILES: C(CC(O)=O)(N)C1=C(C=CC=C1)C2=CC=CC=C2

Synonyms:

• β-Amino[1,1′-biphenyl]-2-propanoic acid
• [1,1′-Biphenyl]-2-propanoic acid, β-amino-