CAS 773128-24-8
:N-[(1,1-Dimethylethoxy)carbonyl]-3-iodo-L-alanine
Description:
N-[(1,1-Dimethylethoxy)carbonyl]-3-iodo-L-alanine is a synthetic amino acid derivative characterized by the presence of an iodine atom at the 3-position of the L-alanine backbone. This compound features a dimethylethoxycarbonyl group, which enhances its stability and solubility in organic solvents. The iodine substitution introduces unique reactivity, making it useful in various chemical synthesis applications, particularly in peptide synthesis and medicinal chemistry. The presence of the carboxyl group allows it to participate in typical amino acid reactions, while the bulky dimethylethoxy group can influence the steric and electronic properties of the molecule. This compound is typically used in research settings, particularly in the development of pharmaceuticals and biologically active compounds. Its specific properties, such as melting point, solubility, and reactivity, can vary based on the conditions under which it is handled. As with many chemical substances, proper safety precautions should be observed when working with this compound due to its potential biological activity and reactivity.
Formula:C8H14INO4
InChI:InChI=1S/C8H14INO4/c1-8(2,3)14-7(13)10-5(4-9)6(11)12/h5H,4H2,1-3H3,(H,10,13)(H,11,12)/t5-/m0/s1
InChI key:InChIKey=VPJPNDRAPYPUPA-YFKPBYRVSA-N
SMILES:[C@@H](NC(OC(C)(C)C)=O)(C(O)=O)CI
Synonyms:- N-[(1,1-Dimethylethoxy)carbonyl]-3-iodo-L-alanine
- L-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
