CAS 773129-48-9

3-(4-Fluoro-2-methylphenyl)-2-propenoic acid

Description:

3-(4-Fluoro-2-methylphenyl)-2-propenoic acid, identified by its CAS number 773129-48-9, is an organic compound characterized by its propenoic acid structure, which features a double bond between the second and third carbon atoms of the propene chain. The presence of a 4-fluoro-2-methylphenyl group indicates that a fluorine atom and a methyl group are substituted on the aromatic ring, influencing the compound's reactivity and physical properties. This compound typically exhibits properties associated with unsaturated carboxylic acids, such as acidity due to the carboxyl functional group, and it may participate in various chemical reactions, including polymerization and esterification. Its fluorinated aromatic ring can enhance lipophilicity and alter biological activity, making it of interest in pharmaceutical and agrochemical research. The compound's solubility, melting point, and boiling point can vary based on its molecular interactions and the presence of functional groups. Overall, 3-(4-Fluoro-2-methylphenyl)-2-propenoic acid is a versatile compound with potential applications in various chemical fields.

Formula: C₁₀H₉FO₂

InChI: InChI=1S/C10H9FO2/c1-7-6-9(11)4-2-8(7)3-5-10(12)13/h2-6H,1H3,(H,12,13)

InChI key: InChIKey=PYZZLFVFTBBWEK-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)C1=C(C)C=C(F)C=C1

Synonyms:

• 4-Fluoro-2-methylcinnamic acid
• 2-Propenoic acid, 3-(4-fluoro-2-methylphenyl)-
• 3-(4-Fluoro-2-methylphenyl)-2-propenoic acid

4-Fluoro-2-methylcinnamic acid

CAS: 773129-48-9

4-Fluoro-2-methylcinnamic acid

Purity: 95%

Color and Shape: Solid

Molecular weight: 180.18g/mol

Ref: 54-PC52468