CAS 773134-57-9

Ethyl 3-fluoro-2-hydroxybenzoate

Description:

Ethyl 3-fluoro-2-hydroxybenzoate, with the CAS number 773134-57-9, is an organic compound that belongs to the class of benzoate esters. It features a benzoic acid derivative where a hydroxyl group (-OH) and a fluorine atom are substituted on the aromatic ring. This compound typically exhibits a moderate polarity due to the presence of the hydroxyl group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The fluorine atom can enhance the compound's lipophilicity and may affect its reactivity and biological activity. Ethyl 3-fluoro-2-hydroxybenzoate is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as boiling point and melting point, can vary based on purity and specific conditions. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₉H₉FO₃

InChI: InChI=1S/C9H9FO3/c1-2-13-9(12)6-4-3-5-7(10)8(6)11/h3-5,11H,2H2,1H3

InChI key: InChIKey=MWQUIKBBCVZWAL-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(O)C(F)=CC=C1

Synonyms:

• Benzoic acid, 3-fluoro-2-hydroxy-, ethyl ester
• Ethyl 3-fluoro-2-hydroxybenzoate