CymitQuimica logo

CAS 773134-71-7

:

Ethyl 4-ethoxy-3-methoxybenzoate

Description:
Ethyl 4-ethoxy-3-methoxybenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. This compound features a benzene ring substituted with both ethoxy and methoxy groups, contributing to its unique chemical properties. The presence of these alkoxy groups enhances its solubility in organic solvents and may influence its reactivity and interactions with other chemical species. Ethyl 4-ethoxy-3-methoxybenzoate is typically a colorless to pale yellow liquid with a pleasant odor, making it potentially useful in fragrance applications. Its molecular structure suggests it may exhibit moderate polarity, allowing for various applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the compound's stability under standard conditions makes it suitable for various chemical processes. However, as with all chemical substances, proper handling and safety precautions should be observed due to potential toxicity or environmental impact.
Formula:C12H16O4
InChI:InChI=1S/C12H16O4/c1-4-15-10-7-6-9(8-11(10)14-3)12(13)16-5-2/h6-8H,4-5H2,1-3H3
InChI key:InChIKey=ONAWEDBUJZYTQQ-UHFFFAOYSA-N
SMILES:O(CC)C1=C(OC)C=C(C(OCC)=O)C=C1
Synonyms:
  • Benzoic acid, 4-ethoxy-3-methoxy-, ethyl ester
  • Ethyl 4-ethoxy-3-methoxybenzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.