CAS 77314-23-9
:N-Hydroxy-3-methyl-3H-imidazo[4,5-f]quinolin-2-amine
Description:
N-Hydroxy-3-methyl-3H-imidazo[4,5-f]quinolin-2-amine is a chemical compound characterized by its unique imidazoquinoline structure, which incorporates a hydroxylamine functional group. This compound typically exhibits properties associated with heterocyclic amines, including potential biological activity due to its ability to interact with various biological targets. The presence of the hydroxylamine group suggests it may participate in redox reactions, potentially acting as a reducing agent or a nucleophile. Its molecular structure contributes to its solubility and reactivity, which can vary depending on the solvent and environmental conditions. N-Hydroxy-3-methyl-3H-imidazo[4,5-f]quinolin-2-amine may also exhibit fluorescence properties, making it of interest in various analytical applications. Additionally, compounds of this class have been studied for their potential pharmacological effects, including antimicrobial and anticancer activities. However, specific biological activities and applications would require further investigation and validation through experimental studies.
Formula:C11H10N4O
InChI:InChI=1S/C11H10N4O/c1-15-9-5-4-8-7(3-2-6-12-8)10(9)13-11(15)14-16/h2-6,16H,1H3,(H,13,14)
InChI key:InChIKey=QYFQSQCBYZOECM-UHFFFAOYSA-N
SMILES:CN1C2=C(C=3C(C=C2)=NC=CC3)NC1=NO
Synonyms:- N-Hydroxy-3-methyl-3H-imidazo[4,5-f]quinolin-2-amine
- 2-Hydroxyamino-3-methylimidazo[4,5-f]quinoline
- 2H-Imidazo[4,5-f]quinolin-2-one, 1,3-dihydro-3-methyl-, oxime
- 3H-Imidazo[4,5-f]quinolin-2-amine, N-hydroxy-3-methyl-
- N-Hydroxy-IQ
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Hydroxyamino-3-methyl-3H-imidazo[4,5-f]quinoline
CAS:Controlled ProductStability Light Sensitive
Applications 2-Hydroxy derivative of the mutagenic heterocyclic amine, IQ.
References Davis, C., et al.: Toxicol. App. Pharmacol., 124, 201 (1994), Kim, D., et al.: Chem. Res. Toxicol., 17, 529 (2004), Lakshmi, V., et al.: Food Chem. Toxicol., 43, 1607 (2005),Formula:C11H10N4OColor and Shape:NeatMolecular weight:214.222-Hydroxyamino-3-methyl-3H-imidazo[4,5-f]quinoline
CAS:2-Hydroxyamino-3-methyl-3H-imidazo[4,5-f]quinoline (2HAIQ) is a reactive compound that binds to DNA. It has been shown to be a potent inhibitor of the enzyme cytosolic protein kinase C, which plays an important role in regulating cellular metabolism. 2HAIQ also inhibits the activity of enzymes such as hydroxylases and polymerases. The binding of 2HAIQ to DNA is thought to inhibit transcription by preventing RNA polymerase from transcribing DNA. 2HAIQ may also inhibit replication by binding to the dinucleotide phosphate molecule, which is essential for DNA synthesis.Formula:C11H10N4OPurity:Min. 95%Molecular weight:214.22 g/mol

