CAS 7732-32-3
:3,5-Dihydroxybenzhydrazide
Description:
It appears there is a mix-up with the CAS number provided. The CAS number 7732-32-3 corresponds to water (H₂O), not 3,5-Dihydroxybenzhydrazide. However, 3,5-Dihydroxybenzhydrazide is an organic compound characterized by the presence of two hydroxyl (-OH) groups attached to a benzene ring and a hydrazide functional group. This compound typically exhibits properties such as being a white to off-white solid, and it is soluble in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. It may be used in various applications, including as a reagent in organic synthesis or in the development of pharmaceuticals. The presence of the hydrazide moiety suggests potential biological activity, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the pH of the environment and the presence of other functional groups.
Formula:C7H8N2O3
InChI:InChI=1/C7H8N2O3/c8-9-7(12)4-1-5(10)3-6(11)2-4/h1-3,10-11H,8H2,(H,9,12)
SMILES:c1c(cc(cc1O)O)C(=NN)O
Synonyms:- 3,5-Dihydroxybenzohydrazide
- Benzoic acid, 3,5-dihydroxy-, hydrazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Dihydroxybenzhydrazide, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H8N2O3Purity:98%Color and Shape:Crystals or powder or crystalline powder, White to creamMolecular weight:168.153,5-Dihydroxybenzhydrazide
CAS:Formula:C7H8N2O3Purity:98%Color and Shape:SolidMolecular weight:168.1500



