
CAS 77326-42-2
:2-Amino-6-(1-methylethoxy)benzonitrile
Description:
2-Amino-6-(1-methylethoxy)benzonitrile, with the CAS number 77326-42-2, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group and a benzonitrile group. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, making it potentially soluble in polar solvents. The 1-methylethoxy group contributes to its hydrophobic characteristics, influencing its solubility and reactivity. This compound may exhibit biological activity due to the amino group, which can interact with various biological targets. Additionally, the nitrile group (-C≡N) can serve as a functional handle for further chemical modifications. The compound's properties, such as melting point, boiling point, and reactivity, would depend on its molecular interactions and the specific conditions under which it is studied. Overall, 2-Amino-6-(1-methylethoxy)benzonitrile is of interest in synthetic organic chemistry and potentially in pharmaceutical applications.
Formula:C10H12N2O
InChI:InChI=1S/C10H12N2O/c1-7(2)13-10-5-3-4-9(12)8(10)6-11/h3-5,7H,12H2,1-2H3
InChI key:InChIKey=RYISSXVPEBQKPZ-UHFFFAOYSA-N
SMILES:C(#N)C1=C(OC(C)C)C=CC=C1N
Synonyms:- 2-Amino-6-(1-methylethoxy)benzonitrile
- 2-Amino-6-(propan-2-yloxy)benzonitrile
- 2-Amino-6-isopropoxybenzonitrile
- Benzonitrile, 2-amino-6-(1-methylethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.