CAS 77326-45-5
:2-Aminocarbonyl-3-nitrobenzoic acid
Description:
2-Aminocarbonyl-3-nitrobenzoic acid, also known by its CAS number 77326-45-5, is an organic compound characterized by the presence of both amino and nitro functional groups attached to a benzoic acid framework. This compound features a carboxylic acid group (-COOH) that contributes to its acidic properties, while the amino group (-NH2) can participate in hydrogen bonding and may influence its solubility in polar solvents. The nitro group (-NO2) is known for its electron-withdrawing properties, which can affect the reactivity of the compound in various chemical reactions. Typically, this substance is a solid at room temperature and may exhibit moderate solubility in water, depending on the pH of the solution. Its unique structure allows it to be utilized in various applications, including pharmaceuticals and organic synthesis, where it may serve as an intermediate or a building block for more complex molecules. Safety data should be consulted for handling and storage, as compounds with nitro groups can sometimes be hazardous.
Formula:C8H6N2O5
InChI:InChI=1/C8H6N2O5/c9-7(11)6-4(8(12)13)2-1-3-5(6)10(14)15/h1-3H,(H2,9,11)(H,12,13)
SMILES:c1cc(c(c(c1)N(=O)=O)C(=N)O)C(=O)O
Synonyms:- Benzoic Acid, 2-(Aminocarbonyl)-3-Nitro-
- 2-Carbamoyl-3-Nitrobenzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-carbamoyl-3-nitrobenzoic acid
CAS:2-Carbamoyl-3-nitrobenzoic acid (2CNB) is an antiviral drug that has been shown to inhibit the replication of a variety of viruses, including coxsackievirus B3 and human respiratory syncytial virus. 2CNB is a mesomeric compound that can be used as a sodium salt or in its unreactive form. The antiviral effects are due to the inhibition of viral protein synthesis by 2CNB. 2CNB binds to amino acids in proteins, blocking the formation of amide bonds, which are necessary for protein synthesis. The antiviral activity of 2CNB is due to its ability to inhibit betaines and betaine, which are important intermediates in RNA synthesis.Formula:C8H6N2O5Purity:Min. 95%Molecular weight:210.1 g/mol

