CAS 7733-29-1
:Z-Orn(Boc)-OH
Description:
The chemical substance "Z-Orn(Boc)-OH," also known as Z-ornithine (Boc) hydroxylamine, is a derivative of the amino acid ornithine, which is involved in the urea cycle and protein synthesis. The "Z" refers to the benzyloxycarbonyl (Z) protecting group, which is commonly used in peptide synthesis to protect the amino group from unwanted reactions. The "Boc" (tert-butyloxycarbonyl) group is another protective group that shields the amino group, facilitating selective reactions during synthesis. The presence of the hydroxyl (-OH) group indicates that this compound can participate in hydrogen bonding and may exhibit solubility in polar solvents. Z-Orn(Boc)-OH is typically used in organic synthesis, particularly in the preparation of peptides and other complex molecules. Its structure allows for the introduction of various functional groups while maintaining the integrity of the ornithine backbone. As with many chemical substances, proper handling and storage are essential due to potential reactivity and safety considerations.
Formula:C18H26N2O6
InChI:InChI=1/C18H26N2O6/c1-18(2,3)26-16(23)19-11-7-10-14(15(21)22)20-17(24)25-12-13-8-5-4-6-9-13/h4-6,8-9,14H,7,10-12H2,1-3H3,(H,19,23)(H,20,24)(H,21,22)
SMILES:CC(C)(C)OC(=NCCCC(C(=O)O)N=C(O)OCc1ccccc1)O
Synonyms:- N-a-CBZ-(N-d-BOC)-L-Orn
- N~2~-[(benzyloxy)carbonyl]-N~5~-(tert-butoxycarbonyl)ornithine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Nα-Benzyloxycarbonyl-Nδ-Boc-L-ornithine, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C18H26N2O6Purity:98%Molecular weight:366.41Z-Orn(Boc)-OH
CAS:<p>Bachem ID: 4000362.</p>Formula:C18H26N2O6Purity:> 99%Color and Shape:White PowderMolecular weight:366.41L-Ornithine, N5-[(1,1-dimethylethoxy)carbonyl]-N2-[(phenylmethoxy)carbonyl]-
CAS:Formula:C18H26N2O6Purity:97%Color and Shape:SolidMolecular weight:366.4088(S)-2-(((Benzyloxy)carbonyl)amino)-5-((tert-butoxycarbonyl)amino)pentanoic acid
CAS:(S)-2-(((Benzyloxy)carbonyl)amino)-5-((tert-butoxycarbonyl)amino)pentanoic acidPurity:97%Molecular weight:366.41g/mol(S)-2-(((Benzyloxy)carbonyl)amino)-5-((tert-butoxycarbonyl)amino)pentanoic acid
CAS:Formula:C18H26N2O6Purity:95%Color and Shape:SolidMolecular weight:366.414




