CAS 77332-64-0

1-bromo-5-iodonaphthalene

Description:

1-Bromo-5-iodonaphthalene is an organic compound characterized by the presence of both bromine and iodine substituents on the naphthalene ring system. It features a naphthalene backbone, which consists of two fused benzene rings, with a bromine atom attached to one carbon and an iodine atom attached to the fifth carbon of the naphthalene structure. This compound is typically a solid at room temperature and is known for its relatively low solubility in water, but it is soluble in organic solvents such as dichloromethane and acetone. The presence of halogens (bromine and iodine) contributes to its reactivity, making it useful in various chemical reactions, including cross-coupling reactions in organic synthesis. Additionally, 1-bromo-5-iodonaphthalene can serve as a precursor for the synthesis of more complex organic molecules and is of interest in materials science and medicinal chemistry due to its potential applications in developing new pharmaceuticals and functional materials. Safety precautions should be taken when handling this compound, as both bromine and iodine are hazardous substances.

Formula: C₁₀H₆BrI

InChI: InChI=1/C10H6BrI/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1-6H

SMILES: c1cc2c(cccc2I)c(c1)Br

1-Bromo-5-iodonaphthalene

CAS: 77332-64-0

Formula: C₁₀H₆BrI

Purity: 95%

Color and Shape: Solid

Molecular weight: 332.9631

Ref: IN-DA005BV1

1-Bromo-5-iodonaphthalene

CAS: 77332-64-0

1-Bromo-5-iodonaphthalene

Purity: 95%

Molecular weight: 332.96g/mol

Ref: 54-OR88023

1-Bromo-5-iodonaphthalene

CAS: 77332-64-0

Purity: 95%

Molecular weight: 332.9660034

Ref: 10-F750460

1-Bromo-5-iodonaphthalene

CAS: 77332-64-0

1-Bromo-5-iodonaphthalene is a photolytic reagent that can be used for the preparation of phenols. It is a strong nucleophilic brominating agent and reacts with electron-rich compounds such as phenols, amines, and alcohols to form corresponding bromides. 1-Bromo-5-iodonaphthalene can also react with electron deficient compounds such as aromatic hydrocarbons and nitrobenzenes to form radical species. The photolysis of 1-bromo-5-iodonaphthalene in aqueous solution produces naphthalenes. This reaction is dependent on the pH of the solution and irradiation time. The solubility of 1-bromo-5-iodonaphthalene in water decreases when the pH increases.

Formula: C₁₀H₆BrI

Purity: Min. 95%

Molecular weight: 332.96 g/mol

Ref: 3D-CDA33264