CAS 77332-65-1

1-bromo-5-chloronaphthalene

Description:

1-Bromo-5-chloronaphthalene is an organic compound characterized by the presence of both bromine and chlorine substituents on a naphthalene ring system. It features a bromine atom at the first position and a chlorine atom at the fifth position of the naphthalene structure, which consists of two fused benzene rings. This compound is typically a colorless to pale yellow solid at room temperature and is known for its aromatic properties. It is relatively insoluble in water but soluble in organic solvents such as ethanol and dichloromethane. The presence of halogens in its structure contributes to its reactivity, making it useful in various chemical synthesis processes, including the production of pharmaceuticals and agrochemicals. Additionally, 1-bromo-5-chloronaphthalene can participate in electrophilic substitution reactions due to the electron-withdrawing effects of the halogen substituents. Safety precautions should be taken when handling this compound, as it may pose health risks and environmental hazards.

Formula: C₁₀H₆BrCl

InChI: InChI=1/C10H6BrCl/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1-6H

Synonyms:

• 1-bromo-5-chloronaphthalene
• Naphthalene, 1-bromo-5-chloro-
• 88-10028,1-BROMO-5-CHLORONAPHTHALENE

1-Bromo-5-chloronaphthalene

CAS: 77332-65-1

Formula: C₁₀H₆BrCl

Purity: 98%

Color and Shape: Solid

Molecular weight: 241.5116

Ref: IN-DA003A07

1-bromo-5-chloronaphthalene

CAS: 77332-65-1

1-bromo-5-chloronaphthalene

Purity: 98%

Molecular weight: 241.51g/mol

Ref: 54-OR1043533

1-Bromo-5-chloronaphthalene

CAS: 77332-65-1

Purity: 98%

Molecular weight: 241.5099945

Ref: 10-F618990