CymitQuimica logo

CAS 77333-20-1

:

N3,N3,N5,N5-Tetramethyl-1,2,4,3,5-trithiadiborolane-3,5-diamine

Description:
N3,N3,N5,N5-Tetramethyl-1,2,4,3,5-trithiadiborolane-3,5-diamine, with CAS number 77333-20-1, is a specialized organosulfur compound characterized by its unique structural framework that includes a trithiadiborolane core. This compound features a boron-sulfur framework, which contributes to its distinctive chemical properties. The presence of multiple methyl groups enhances its steric bulk and solubility in organic solvents, while the amine functional groups can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The trithiadiborolane structure may exhibit interesting electronic properties due to the presence of boron and sulfur atoms, potentially making it useful in materials science and catalysis. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as temperature and pH. Overall, this compound represents a fascinating area of study within organosulfur chemistry, with potential applications in fields such as synthetic chemistry and materials development.
Formula:C4H12B2N2S3
InChI:InChI=1S/C4H12B2N2S3/c1-7(2)5-9-6(8(3)4)11-10-5/h1-4H3
InChI key:InChIKey=ZNGRFXSBBDKWRF-UHFFFAOYSA-N
SMILES:N(C)(C)B1SB(N(C)C)SS1
Synonyms:
  • N3,N3,N5,N5-Tetramethyl-1,2,4,3,5-trithiadiborolane-3,5-diamine
  • 1,2,4,3,5-Trithiadiborolane-3,5-diamine, N3,N3,N5,N5-tetramethyl-
  • 1,2,4,3,5-Trithiadiborolane-3,5-diamine, N,N,N′,N′-tetramethyl-
  • 3,5-Bis(dimethylamino)-1,2,4,3,5-trithiadiborolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.