CAS 77340-84-2
:2-[(Z)-2-nitro-2-phenylethenyl]pyridine
Description:
2-[(Z)-2-nitro-2-phenylethenyl]pyridine, with the CAS number 77340-84-2, is an organic compound characterized by its unique structure, which includes a pyridine ring and a nitro-substituted phenyl group. This compound features a double bond between the phenyl and the pyridine moiety, specifically in the Z configuration, indicating that the nitro group and the phenyl group are on the same side of the double bond. The presence of the nitro group contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The compound may exhibit interesting electronic properties due to the conjugation between the nitro group and the aromatic systems, which can influence its behavior in chemical reactions. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. Overall, 2-[(Z)-2-nitro-2-phenylethenyl]pyridine is of interest for further studies in fields such as materials science and pharmacology due to its distinctive structural features.
Formula:C13H10N2O2
InChI:InChI=1/C13H10N2O2/c16-15(17)13(11-6-2-1-3-7-11)10-12-8-4-5-9-14-12/h1-10H/b13-10-
SMILES:c1ccc(cc1)/C(=C/c1ccccn1)/N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.