
CAS 77355-06-7
:1,1′-[(3-Aminopropyl)imino]bis[2-propanol]
Description:
1,1′-[(3-Aminopropyl)imino]bis[2-propanol], identified by its CAS number 77355-06-7, is an organic compound characterized by its dual alcohol functional groups and an imino linkage. This substance features a central imino group connecting two 2-propanol moieties, with a 3-aminopropyl substituent that enhances its potential for hydrogen bonding and reactivity. The presence of hydroxyl groups contributes to its solubility in polar solvents, making it useful in various applications, including as a ligand in coordination chemistry or as a potential intermediate in organic synthesis. The amino group can participate in further reactions, such as nucleophilic substitutions or coupling reactions, which may be advantageous in pharmaceutical or materials chemistry. Additionally, the compound's structure suggests it may exhibit biological activity, although specific biological properties would require further investigation. Overall, its unique structure and functional groups make it a compound of interest in both academic research and industrial applications.
Formula:C9H22N2O2
InChI:InChI=1S/C9H22N2O2/c1-8(12)6-11(5-3-4-10)7-9(2)13/h8-9,12-13H,3-7,10H2,1-2H3
InChI key:InChIKey=FYYUTGDAKCRTMZ-UHFFFAOYSA-N
SMILES:N(CC(C)O)(CC(C)O)CCCN
Synonyms:- 1-[(3-Aminopropyl)-(2-hydroxypropyl)-amino]propan-2-ol
- 1,1′-[(3-Aminopropyl)imino]bis[2-propanol]
- 2-Propanol, 1,1′-[(3-aminopropyl)imino]bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.