CAS 77355-07-8

4-(2-Hydroxyethyl)-1-piperazinepropanenitrile

Description:

4-(2-Hydroxyethyl)-1-piperazinepropanenitrile, with the CAS number 77355-07-8, is a chemical compound characterized by its piperazine structure, which includes a piperazine ring substituted with a hydroxyethyl group and a propanenitrile moiety. This compound typically exhibits properties associated with both amines and nitriles, such as potential solubility in polar solvents due to the presence of the hydroxyethyl group. The piperazine ring contributes to its basicity and potential reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the nitrile group may impart specific reactivity, allowing for further chemical modifications. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry contexts. Safety and handling considerations should be observed, as with many organic compounds, particularly those containing functional groups that may be reactive or toxic. Overall, this compound's unique structure positions it as a versatile building block in synthetic organic chemistry.

Formula: C₉H₁₇N₃O

InChI: InChI=1S/C9H17N3O/c10-2-1-3-11-4-6-12(7-5-11)8-9-13/h13H,1,3-9H2

InChI key: InChIKey=ZAZQLPKNEYEAIO-UHFFFAOYSA-N

SMILES: C(CC#N)N1CCN(CCO)CC1

Synonyms:

• 4-(2-Hydroxyethyl)-1-piperazinepropanenitrile
• 1-Piperazinepropanenitrile, 4-(2-hydroxyethyl)-