CAS 77359-11-6
:Malonicacidmononitrobenzylester
Description:
Malonic acid mononitrobenzyl ester, identified by the CAS number 77359-11-6, is an organic compound characterized by its ester functional group derived from malonic acid and nitrobenzyl alcohol. This compound typically exhibits a moderate polarity due to the presence of both the ester and nitro groups, which can influence its solubility in various organic solvents. The nitro group contributes to its potential reactivity, making it a candidate for further chemical transformations. In terms of physical properties, malonic acid mononitrobenzyl ester may display a distinct melting point and boiling point, which are influenced by its molecular structure. The compound is of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. Safety data should be consulted for handling and storage, as compounds with nitro groups can pose specific hazards. Overall, malonic acid mononitrobenzyl ester serves as a versatile building block in chemical synthesis.
Formula:C10H9NO6
InChI:InChI=1/C10H9NO6/c12-9(13)5-10(14)17-6-7-1-3-8(4-2-7)11(15)16/h1-4H,5-6H2,(H,12,13)
SMILES:c1cc(ccc1COC(=O)CC(=O)O)N(=O)=O
Synonyms:- Malonic acid mono-4-nitrobenzyl ester
- Mono(4-Nitrobenzyl) Malonate
- Mono-P-Nitrobenzyl Malonate
- Malonic acid mono-p-nitrobenzyl ester
- 4-Nitrobenzyl hydrogen malonate
- Mono-4-nitrobenzylmalonicacidester
- 4-Nitrobenzylhydrogenmalonate
- Mono-4-nitrobenzylmalonate
- 3-[(4-Nitrobenzyl)oxy]-3-oxopropanoicacid
- 3-[(4-Nitrobenzyl)Oxy]-3-Oxopropanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Mono-4-nitrobenzyl Malonate
CAS:Formula:C10H9NO6Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:239.183-((4-Nitrobenzyl)oxy)-3-oxopropanoic acid
CAS:Formula:C10H9NO6Purity:97%Color and Shape:SolidMolecular weight:239.18163-((4-Nitrobenzyl)oxy)-3-oxopropanoic acid
CAS:Formula:C10H9NO6Purity:97%Color and Shape:SolidMolecular weight:239.183



