CAS 77359-18-3
:(1E)-1-(2-Methylphenyl)ethanone 2-(4,6-dimethyl-2-pyrimidinyl)hydrazone
Description:
(1E)-1-(2-Methylphenyl)ethanone 2-(4,6-dimethyl-2-pyrimidinyl)hydrazone, with the CAS number 77359-18-3, is a chemical compound characterized by its hydrazone functional group, which is formed from the reaction of a ketone and a hydrazine derivative. This compound features a 2-methylphenyl group attached to an ethanone moiety, indicating it has aromatic characteristics and potential for various interactions due to the presence of the methyl substituent. The pyrimidine ring in the hydrazone structure contributes to its heterocyclic nature, which can influence its reactivity and biological activity. The presence of multiple methyl groups on the pyrimidine ring suggests increased steric hindrance, which may affect the compound's solubility and stability. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The specific properties, such as melting point, boiling point, and solubility, would require experimental determination or literature reference for precise values.
Formula:C15H18N4
InChI:InChI=1S/C15H18N4/c1-10-7-5-6-8-14(10)13(4)18-19-15-16-11(2)9-12(3)17-15/h5-9H,1-4H3,(H,16,17,19)/b18-13+
InChI key:InChIKey=GOWLARCWZRESHU-QGOAFFKASA-N
SMILES:C(=N\NC=1N=C(C)C=C(C)N1)(\C)/C2=C(C)C=CC=C2
Synonyms:- Ethanone, 1-(2-methylphenyl)-, 2-(4,6-dimethyl-2-pyrimidinyl)hydrazone, (1E)-
- 2(1H)-Pyrimidinone, 4,6-dimethyl-, (2E)-[1-(2-methylphenyl)ethylidene]hydrazone
- (1E)-1-(2-Methylphenyl)ethanone 2-(4,6-dimethyl-2-pyrimidinyl)hydrazone
- 2(1H)-Pyrimidinone, 4,6-dimethyl-, [1-(2-methylphenyl)ethylidene]hydrazone, (?,E)-
- (E)-Ferimzone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(1E)-1-(2-Methylphenyl)ethanone 2-(4,6-dimethyl-2-pyrimidinyl)hydrazone
CAS:Controlled ProductFormula:C15H18N4Color and Shape:NeatMolecular weight:254.33

