CymitQuimica logo

CAS 77366-71-3

:

2,3-Dihydro-6-methoxy-3-oxo-1H-indene-5-carboxylic acid

Description:
2,3-Dihydro-6-methoxy-3-oxo-1H-indene-5-carboxylic acid, with the CAS number 77366-71-3, is an organic compound characterized by its indene structure, which features a fused bicyclic system. This compound contains a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a methoxy group (–OCH3) enhances its solubility in organic solvents and may influence its biological activity. The keto group (C=O) at the 3-position indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The compound's structure suggests it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 2,3-Dihydro-6-methoxy-3-oxo-1H-indene-5-carboxylic acid represents a versatile scaffold for further chemical modifications and applications in research and industry.
Formula:C11H10O4
InChI:InChI=1S/C11H10O4/c1-15-10-4-6-2-3-9(12)7(6)5-8(10)11(13)14/h4-5H,2-3H2,1H3,(H,13,14)
InChI key:InChIKey=CSECSQHRXAOUKM-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(OC)=C(C(O)=O)C2)CC1
Synonyms:
  • 2,3-Dihydro-6-methoxy-3-oxo-1H-indene-5-carboxylic acid
  • 6-Methoxy-3-oxoindane-5-carboxylic acid
  • 1H-Indene-5-carboxylic acid, 2,3-dihydro-6-methoxy-3-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.