CymitQuimica logo

CAS 77368-59-3

:

2-[({[2-amino-4-hydroxy-4-(5-hydroxypyridin-2-yl)-3-methylbutanoyl]amino}[5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl]acetyl)amino]pentanedioic acid (non-preferred name)

Description:
The chemical substance with the name "2-[({[2-amino-4-hydroxy-4-(5-hydroxypyridin-2-yl)-3-methylbutanoyl]amino}[5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl]acetyl)amino]pentanedioic acid" and CAS number 77368-59-3 is a complex organic compound characterized by multiple functional groups, including amino, hydroxyl, and carboxylic acid groups. This structure suggests potential biological activity, possibly as a pharmaceutical agent or a biochemical probe. The presence of a pyridine ring and a pyrimidine moiety indicates potential interactions with biological targets, such as enzymes or receptors. The compound's solubility and stability would depend on its specific functional groups and the overall molecular structure, which may influence its pharmacokinetic properties. Additionally, the intricate arrangement of substituents may contribute to its reactivity and interaction with other molecules. Overall, this compound exemplifies the complexity often found in bioactive molecules, highlighting the interplay between structure and function in medicinal chemistry.
Formula:C25H32N6O13
InChI:InChI=1/C25H32N6O13/c1-9(17(36)11-3-2-10(32)8-27-11)15(26)21(39)30-16(22(40)28-12(24(41)42)4-5-14(34)35)20-18(37)19(38)23(44-20)31-7-6-13(33)29-25(31)43/h2-3,6-9,12,15-20,23,32,36-38H,4-5,26H2,1H3,(H,28,40)(H,30,39)(H,34,35)(H,41,42)(H,29,33,43)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.