
CAS 77369-28-9
:1-Amino-2-butanone
Description:
1-Amino-2-butanone, with the CAS number 77369-28-9, is an organic compound characterized by the presence of both an amino group (-NH2) and a carbonyl group (C=O) within its structure. This compound is classified as an alpha-amino ketone, which means that the amino group is attached to the carbon adjacent to the carbonyl group. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. 1-Amino-2-butanone is soluble in water and polar organic solvents, making it versatile for use in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity and functional groups make it a valuable compound in the field of organic chemistry, particularly in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C4H9NO
InChI:InChI=1S/C4H9NO/c1-2-4(6)3-5/h2-3,5H2,1H3
InChI key:InChIKey=QCWWEZIJUCPALZ-UHFFFAOYSA-N
SMILES:C(CC)(CN)=O
Synonyms:- 2-Butanone, 1-amino-
- 1-Amino-2-butanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.