CAS 77370-02-6

4-(5,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol

Description:

4-(5,7-Dimethoxy-3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol, with the CAS number 77370-02-6, is a chemical compound that belongs to the class of flavonoids, specifically a derivative of chromen. This substance features a chromen backbone substituted with methoxy groups and a benzene-1,3-diol moiety, which contributes to its potential biological activity. The presence of multiple hydroxyl groups suggests that it may exhibit antioxidant properties, which are common in flavonoids. The methoxy groups can enhance the lipophilicity of the compound, potentially influencing its bioavailability and interaction with biological systems. Additionally, the structural characteristics may allow for various interactions with enzymes or receptors, making it of interest in pharmacological research. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, which are crucial for its application in medicinal chemistry or as a dietary supplement. Further studies would be necessary to fully elucidate its properties and potential therapeutic effects.

Formula: C₁₇H₁₈O₅

InChI: InChI=1/C17H18O5/c1-20-12-7-16(21-2)14-5-10(9-22-17(14)8-12)13-4-3-11(18)6-15(13)19/h3-4,6-8,10,18-19H,5,9H2,1-2H3

InChI key: InChIKey=ITRZCICEVGLQFO-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=CC(OC)=C1)OCC(C2)C3=C(O)C=C(O)C=C3

Synonyms:

• 1,3-Benzenediol, 4-(3,4-dihydro-5,7-dimethoxy-2H-1-benzopyran-3-yl)-
• Lotisoflavan
• 1,3-Benzenediol, 4-(3,4-dihydro-5,7-dimethoxy-2H-1-benzopyran-3-yl)- (9CI)

Lotisoflavan

CAS: 77370-02-6

Phytoalexin isolated from the fungus-inoculated leaflets of Lotus angustissimus

Formula: C₁₇H₁₈O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 302.32 g/mol

Ref: 3D-XL161806