CAS 77374-29-9
:p-Boronophenylalanine
Description:
p-Boronophenylalanine (BPA) is a non-natural amino acid that features a boron atom attached to the phenyl group of the phenylalanine structure. Its chemical formula is C9H12BNO2, and it is characterized by the presence of a boron atom, which imparts unique properties that are useful in various applications, particularly in the field of cancer treatment and radiation therapy. BPA is known for its ability to enhance the effectiveness of boron neutron capture therapy (BNCT), a targeted cancer treatment that utilizes the neutron capture reaction of boron-10 isotopes. The compound is typically a white to off-white solid and is soluble in water, making it suitable for biological applications. Additionally, its incorporation into peptides and proteins can be achieved through standard peptide synthesis techniques. The presence of the boron atom allows for specific interactions with biological systems, making BPA a subject of interest in medicinal chemistry and drug development. Safety and handling precautions are necessary due to its chemical nature, and it should be used in accordance with established guidelines.
Formula:C9H12BNO4
InChI:InChI=1S/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)
InChI key:InChIKey=NFIVJOSXJDORSP-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)N)C1=CC=C(B(O)O)C=C1
Synonyms:- 4-Boronophenylalanine
- Phenylalanine, 4-borono-
- Alanine, 3-(p-boronophenyl)-
- DL-p-Boronophenylalanine
- p-Boronophenylalanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
