CAS 77375-78-1
:2-(3-Aminopropyl)-6-phenyl-3(2H)-pyridazinone
Description:
2-(3-Aminopropyl)-6-phenyl-3(2H)-pyridazinone, identified by its CAS number 77375-78-1, is a chemical compound that belongs to the class of pyridazinones, which are characterized by a pyridazine ring fused with a carbonyl group. This compound features an aminoalkyl side chain, specifically a 3-aminopropyl group, which contributes to its potential biological activity. The presence of a phenyl group enhances its lipophilicity, possibly influencing its interaction with biological targets. Pyridazinones are often studied for their pharmacological properties, including anti-inflammatory and analgesic effects. The structural characteristics of this compound suggest it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its reactivity and solubility in various solvents. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry and drug development. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C13H15N3O
InChI:InChI=1S/C13H15N3O/c14-9-4-10-16-13(17)8-7-12(15-16)11-5-2-1-3-6-11/h1-3,5-8H,4,9-10,14H2
InChI key:InChIKey=YSPMOKARTYZIID-UHFFFAOYSA-N
SMILES:C(CCN)N1N=C(C=CC1=O)C2=CC=CC=C2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.